C25H20N4O3S — CID 25287471
(4S)-1-(4-methyl-2-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 25287471) has the molecular formula C25H20N4O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is (4S)-1-(4-methyl-2-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-1-(4-methyl-2-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 25287471 |
| Molecular Formula | C25H20N4O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (4S)-1-(4-methyl-2-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4-thiophen-2-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccc(N2C3=C(C(=O)CCC3)[C@@H](c3cccs3)C(C#N)=C2n2cccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20N4O3S/c1-16-9-10-18(20(14-16)29(31)32)28-19-6-4-7-21(30)24(19)23(22-8-5-13-33-22)17(15-26)25(28)27-11-2-3-12-27/h2-3,5,8-14,23H,4,6-7H2,1H3/t23-/m1/s1 |
| InChIKey | ZKKXABFLNZRQHU-HSZRJFAPSA-N |
| XLogP | 5.77 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|