C28H26N4O3S — CID 5296652
7,7-dimethyl-1-(4-methyl-2-nitrophenyl)-4-(3-methylthiophen-2-yl)-5-oxo-2-pyrrol-1-yl-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 5296652) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 7,7-dimethyl-1-(4-methyl-2-nitrophenyl)-4-(3-methylthiophen-2-yl)-5-oxo-2-pyrrol-1-yl-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 7,7-dimethyl-1-(4-methyl-2-nitrophenyl)-4-(3-methylthiophen-2-yl)-5-oxo-2-pyrrol-1-yl-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5296652 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 7,7-dimethyl-1-(4-methyl-2-nitrophenyl)-4-(3-methylthiophen-2-yl)-5-oxo-2-pyrrol-1-yl-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | Cc1ccc(N2C3=C(C(=O)CC(C)(C)C3)C(c3sccc3C)C(C#N)=C2n2cccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H26N4O3S/c1-17-7-8-20(21(13-17)32(34)35)31-22-14-28(3,4)15-23(33)25(22)24(26-18(2)9-12-36-26)19(16-29)27(31)30-10-5-6-11-30/h5-13,24H,14-15H2,1-4H3 |
| InChIKey | HEXAHUBAMAZEHT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 92.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|