C23H21BrN4O4S — CID 5104211
2-amino-4-(5-bromothiophen-2-yl)-1-(4-methoxy-2-nitrophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 5104211) has the molecular formula C23H21BrN4O4S and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-amino-4-(5-bromothiophen-2-yl)-1-(4-methoxy-2-nitrophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(5-bromothiophen-2-yl)-1-(4-methoxy-2-nitrophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5104211 |
| Molecular Formula | C23H21BrN4O4S |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2-amino-4-(5-bromothiophen-2-yl)-1-(4-methoxy-2-nitrophenyl)-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | COc1ccc(N2C(N)=C(C#N)C(c3ccc(Br)s3)C3=C2CC(C)(C)CC3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21BrN4O4S/c1-23(2)9-16-21(17(29)10-23)20(18-6-7-19(24)33-18)13(11-25)22(26)27(16)14-5-4-12(32-3)8-15(14)28(30)31/h4-8,20H,9-10,26H2,1-3H3 |
| InChIKey | XIPGREIRXYYYIT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|