C25H26N4O3S2 — CID 92848928
(4S)-2-amino-4-(3-ethylsulfanylthiophen-2-yl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 92848928) has the molecular formula C25H26N4O3S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (4S)-2-amino-4-(3-ethylsulfanylthiophen-2-yl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-4-(3-ethylsulfanylthiophen-2-yl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 92848928 |
| Molecular Formula | C25H26N4O3S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | (4S)-2-amino-4-(3-ethylsulfanylthiophen-2-yl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | CCSc1ccsc1[C@H]1C(C#N)=C(N)N(c2cc([N+](=O)[O-])ccc2C)C2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C25H26N4O3S2/c1-5-33-20-8-9-34-23(20)21-16(13-26)24(27)28(17-10-15(29(31)32)7-6-14(17)2)18-11-25(3,4)12-19(30)22(18)21/h6-10,21H,5,11-12,27H2,1-4H3/t21-/m0/s1 |
| InChIKey | DOYXPGHKLWYWAT-NRFANRHFSA-N |
| XLogP | 6.02 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|