C27H28N4O5 — CID 5036060
2-amino-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 5036060) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5036060 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxyphenyl)-7,7-dimethyl-1-(2-methyl-5-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3cc([N+](=O)[O-])ccc3C)C3=C2C(=O)CC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C27H28N4O5/c1-15-6-8-17(31(33)34)11-19(15)30-20-12-27(2,3)13-21(32)25(20)24(18(14-28)26(30)29)16-7-9-22(35-4)23(10-16)36-5/h6-11,24H,12-13,29H2,1-5H3 |
| InChIKey | SSBRPIIBBIGPPB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|