C26H18F3N5O3 — CID 42553673
(4S)-1-[2-nitro-4-(trifluoromethyl)phenyl]-5-oxo-4-pyridin-3-yl-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 42553673) has the molecular formula C26H18F3N5O3 and a molecular weight of 505.46 g/mol. Its IUPAC name is (4S)-1-[2-nitro-4-(trifluoromethyl)phenyl]-5-oxo-4-pyridin-3-yl-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-1-[2-nitro-4-(trifluoromethyl)phenyl]-5-oxo-4-pyridin-3-yl-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42553673 |
| Molecular Formula | C26H18F3N5O3 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (4S)-1-[2-nitro-4-(trifluoromethyl)phenyl]-5-oxo-4-pyridin-3-yl-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(n2cccc2)N(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])C2=C(C(=O)CCC2)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C26H18F3N5O3/c27-26(28,29)17-8-9-19(21(13-17)34(36)37)33-20-6-3-7-22(35)24(20)23(16-5-4-10-31-15-16)18(14-30)25(33)32-11-1-2-12-32/h1-2,4-5,8-13,15,23H,3,6-7H2/t23-/m0/s1 |
| InChIKey | AOCWTSWENFSRJF-QHCPKHFHSA-N |
| XLogP | 5.81 |
| TPSA | 105.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|