C25H24O8 — CID 42554652
2-[(1S,6S,13S)-16,17-dimethoxy-12-oxo-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-6-yl]prop-2-enyl acetate (PubChem CID 42554652) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[(1S,6S,13S)-16,17-dimethoxy-12-oxo-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-6-yl]prop-2-enyl acetate.
| Compound Name | 2-[(1S,6S,13S)-16,17-dimethoxy-12-oxo-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-6-yl]prop-2-enyl acetate |
|---|---|
| PubChem CID | 42554652 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[(1S,6S,13S)-16,17-dimethoxy-12-oxo-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14,16,18-hexaen-6-yl]prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)[C@@H]1Cc2c(ccc3c2O[C@@H]2COc4cc(OC)c(OC)cc4[C@@H]2C3=O)O1 |
| InChI | InChI=1S/C25H24O8/c1-12(10-30-13(2)26)18-8-16-17(32-18)6-5-14-24(27)23-15-7-20(28-3)21(29-4)9-19(15)31-11-22(23)33-25(14)16/h5-7,9,18,22-23H,1,8,10-11H2,2-4H3/t18-,22+,23-/m0/s1 |
| InChIKey | PFNURIKAZGDCKX-NMNUPHIUSA-N |
| XLogP | 3.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|