C24H24O5 — CID 163059146
6-but-1-en-2-yl-16-methoxy-17-methyl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14(19),15,17-hexaen-12-one (PubChem CID 163059146) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 6-but-1-en-2-yl-16-methoxy-17-methyl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14(19),15,17-hexaen-12-one.
| Compound Name | 6-but-1-en-2-yl-16-methoxy-17-methyl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14(19),15,17-hexaen-12-one |
|---|---|
| PubChem CID | 163059146 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6-but-1-en-2-yl-16-methoxy-17-methyl-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),9,14(19),15,17-hexaen-12-one |
| SMILES | C=C(CC)C1Cc2c(ccc3c2OC2COc4cc(C)c(OC)cc4C2C3=O)O1 |
| InChI | InChI=1S/C24H24O5/c1-5-12(2)19-10-16-17(28-19)7-6-14-23(25)22-15-9-18(26-4)13(3)8-20(15)27-11-21(22)29-24(14)16/h6-9,19,21-22H,2,5,10-11H2,1,3-4H3 |
| InChIKey | JXJCGVQPZQIORS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|