C25H26O6 — CID 118199561
[(6aS,12aS)-2-methoxy-3-methyl-8-(3-methylbut-2-enyl)-12-oxo-6a,12a-dihydro-6H-chromeno[3,4-b]chromen-9-yl] acetate (PubChem CID 118199561) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is [(6aS,12aS)-2-methoxy-3-methyl-8-(3-methylbut-2-enyl)-12-oxo-6a,12a-dihydro-6H-chromeno[3,4-b]chromen-9-yl] acetate.
| Compound Name | [(6aS,12aS)-2-methoxy-3-methyl-8-(3-methylbut-2-enyl)-12-oxo-6a,12a-dihydro-6H-chromeno[3,4-b]chromen-9-yl] acetate |
|---|---|
| PubChem CID | 118199561 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(6aS,12aS)-2-methoxy-3-methyl-8-(3-methylbut-2-enyl)-12-oxo-6a,12a-dihydro-6H-chromeno[3,4-b]chromen-9-yl] acetate |
| SMILES | COc1cc2c(cc1C)OC[C@H]1Oc3c(ccc(OC(C)=O)c3CC=C(C)C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H26O6/c1-13(2)6-7-16-19(30-15(4)26)9-8-17-24(27)23-18-11-20(28-5)14(3)10-21(18)29-12-22(23)31-25(16)17/h6,8-11,22-23H,7,12H2,1-5H3/t22-,23+/m1/s1 |
| InChIKey | YZUAMEPTUOMLAN-PKTZIBPZSA-N |
| XLogP | 4.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|