C18H16ClF3N2O4S — CID 42555577
[(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] (3R)-3-(4-chlorophenyl)sulfonylbutanoate (PubChem CID 42555577) has the molecular formula C18H16ClF3N2O4S and a molecular weight of 448.85 g/mol. Its IUPAC name is [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] (3R)-3-(4-chlorophenyl)sulfonylbutanoate.
| Compound Name | [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] (3R)-3-(4-chlorophenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 42555577 |
| Molecular Formula | C18H16ClF3N2O4S |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] (3R)-3-(4-chlorophenyl)sulfonylbutanoate |
| SMILES | C[C@H](CC(=O)O/N=C(\N)c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClF3N2O4S/c1-11(29(26,27)15-8-6-14(19)7-9-15)10-16(25)28-24-17(23)12-2-4-13(5-3-12)18(20,21)22/h2-9,11H,10H2,1H3,(H2,23,24)/t11-/m1/s1 |
| InChIKey | MHPJZIAMXBAGSP-LLVKDONJSA-N |
| XLogP | 3.77 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|