C26H28N2O3 — CID 42558013
N-[2-[(2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-yl]-3-(2-methoxyphenyl)propanamide (PubChem CID 42558013) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[2-[(2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-yl]-3-(2-methoxyphenyl)propanamide.
| Compound Name | N-[2-[(2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-yl]-3-(2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 42558013 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-[2-[(2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-7-yl]-3-(2-methoxyphenyl)propanamide |
| SMILES | COc1ccccc1CCC(=O)Nc1ccc2c(c1)CN(Cc1ccccc1O)CC2 |
| InChI | InChI=1S/C26H28N2O3/c1-31-25-9-5-3-6-20(25)11-13-26(30)27-23-12-10-19-14-15-28(18-22(19)16-23)17-21-7-2-4-8-24(21)29/h2-10,12,16,29H,11,13-15,17-18H2,1H3,(H,27,30) |
| InChIKey | BTEWGCGYLLSCKS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|