C19H22N2O3 — CID 110412637
3-(2-methoxyphenyl)-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propanamide (PubChem CID 110412637) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propanamide.
| Compound Name | 3-(2-methoxyphenyl)-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propanamide |
|---|---|
| PubChem CID | 110412637 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-(2-methoxyphenyl)-N-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)propanamide |
| SMILES | COc1ccccc1CCC(=O)Nc1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C19H22N2O3/c1-21-11-12-24-18-13-15(8-9-16(18)21)20-19(22)10-7-14-5-3-4-6-17(14)23-2/h3-6,8-9,13H,7,10-12H2,1-2H3,(H,20,22) |
| InChIKey | NGXTZEJNNDIZNR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|