C24H31N3O3S — CID 42561445
1-[[(2R)-oxolan-2-yl]methyl]-3-[[(2S)-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoyl]amino]thiourea (PubChem CID 42561445) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-[[(2R)-oxolan-2-yl]methyl]-3-[[(2S)-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoyl]amino]thiourea.
| Compound Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[[(2S)-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoyl]amino]thiourea |
|---|---|
| PubChem CID | 42561445 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-[[(2R)-oxolan-2-yl]methyl]-3-[[(2S)-2-[4-(2-phenylpropan-2-yl)phenoxy]propanoyl]amino]thiourea |
| SMILES | C[C@H](Oc1ccc(C(C)(C)c2ccccc2)cc1)C(=O)NNC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C24H31N3O3S/c1-17(22(28)26-27-23(31)25-16-21-10-7-15-29-21)30-20-13-11-19(12-14-20)24(2,3)18-8-5-4-6-9-18/h4-6,8-9,11-14,17,21H,7,10,15-16H2,1-3H3,(H,26,28)(H2,25,27,31)/t17-,21+/m0/s1 |
| InChIKey | JUQDNUJHOYINOJ-LAUBAEHRSA-N |
| XLogP | 3.45 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|