C19H15N3O4 — CID 42563753
2-[(1S)-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 42563753) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 2-[(1S)-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42563753 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[(1S)-1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2noc([C@H](C)N3C(=O)c4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C19H15N3O4/c1-11(22-18(23)14-5-3-4-6-15(14)19(22)24)17-20-16(21-26-17)12-7-9-13(25-2)10-8-12/h3-11H,1-2H3/t11-/m0/s1 |
| InChIKey | HXKPKFHBYNJMDI-NSHDSACASA-N |
| XLogP | 3.10 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|