C24H28FN3O — CID 42567707
1-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-4-(methoxymethyl)piperidine (PubChem CID 42567707) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-4-(methoxymethyl)piperidine.
| Compound Name | 1-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-4-(methoxymethyl)piperidine |
|---|---|
| PubChem CID | 42567707 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-[[3-(3-fluorophenyl)-1-(3-methylphenyl)pyrazol-4-yl]methyl]-4-(methoxymethyl)piperidine |
| SMILES | COCC1CCN(Cc2cn(-c3cccc(C)c3)nc2-c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C24H28FN3O/c1-18-5-3-8-23(13-18)28-16-21(15-27-11-9-19(10-12-27)17-29-2)24(26-28)20-6-4-7-22(25)14-20/h3-8,13-14,16,19H,9-12,15,17H2,1-2H3 |
| InChIKey | XDAHRNRTMXUZHS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |