C19H12ClN5OS — CID 42568908
5-(4-chlorophenyl)-4-methyl-11-(1,3-thiazol-2-yl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 42568908) has the molecular formula C19H12ClN5OS and a molecular weight of 393.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-11-(1,3-thiazol-2-yl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-11-(1,3-thiazol-2-yl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 42568908 |
| Molecular Formula | C19H12ClN5OS |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-11-(1,3-thiazol-2-yl)-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1nn2c(ncc3c(=O)n(-c4nccs4)ccc32)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H12ClN5OS/c1-11-16(12-2-4-13(20)5-3-12)17-22-10-14-15(25(17)23-11)6-8-24(18(14)26)19-21-7-9-27-19/h2-10H,1H3 |
| InChIKey | BXAOXLBZKCPXRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |