C16H9ClF2N4S — CID 42569320
6-(4-chlorophenyl)-3-[(3,5-difluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 42569320) has the molecular formula C16H9ClF2N4S and a molecular weight of 362.79 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-[(3,5-difluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-chlorophenyl)-3-[(3,5-difluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 42569320 |
| Molecular Formula | C16H9ClF2N4S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 6-(4-chlorophenyl)-3-[(3,5-difluorophenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Fc1cc(F)cc(Cc2nnc3sc(-c4ccc(Cl)cc4)nn23)c1 |
| InChI | InChI=1S/C16H9ClF2N4S/c17-11-3-1-10(2-4-11)15-22-23-14(20-21-16(23)24-15)7-9-5-12(18)8-13(19)6-9/h1-6,8H,7H2 |
| InChIKey | YFQJAIYJVXGSNZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |