C27H31IN2O6 — CID 4257084
N-benzyl-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide (PubChem CID 4257084) has the molecular formula C27H31IN2O6 and a molecular weight of 606.46 g/mol. Its IUPAC name is N-benzyl-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide.
| Compound Name | N-benzyl-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 4257084 |
| Molecular Formula | C27H31IN2O6 |
| Molecular Weight | 606.46 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | N-benzyl-N-[6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide |
| SMILES | O=C(NCCO)C1=CC(Oc2ccccc2I)C(O)C(N(Cc2ccccc2)C(=O)C2CCCO2)C1 |
| InChI | InChI=1S/C27H31IN2O6/c28-20-9-4-5-10-22(20)36-24-16-19(26(33)29-12-13-31)15-21(25(24)32)30(17-18-7-2-1-3-8-18)27(34)23-11-6-14-35-23/h1-5,7-10,16,21,23-25,31-32H,6,11-15,17H2,(H,29,33) |
| InChIKey | GEHXKYBAYFDYCA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|