C25H35IN2O7 — CID 6717524
N-(3-ethoxypropyl)-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide (PubChem CID 6717524) has the molecular formula C25H35IN2O7 and a molecular weight of 602.47 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 6717524 |
| Molecular Formula | C25H35IN2O7 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | N-(3-ethoxypropyl)-N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]oxolane-2-carboxamide |
| SMILES | CCOCCCN(C(=O)C1CCCO1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C25H35IN2O7/c1-2-33-13-6-11-28(25(32)21-9-5-14-34-21)19-15-17(24(31)27-10-12-29)16-22(23(19)30)35-20-8-4-3-7-18(20)26/h3-4,7-8,16,19,21-23,29-30H,2,5-6,9-15H2,1H3,(H,27,31)/t19-,21?,22+,23+/m1/s1 |
| InChIKey | ZWTAINLFVDOPFJ-CHYKRTNOSA-N |
| XLogP | 1.64 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|