C25H37IN2O6 — CID 5082343
5-[3-ethoxypropyl(pentanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 5082343) has the molecular formula C25H37IN2O6 and a molecular weight of 588.48 g/mol. Its IUPAC name is 5-[3-ethoxypropyl(pentanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[3-ethoxypropyl(pentanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 5082343 |
| Molecular Formula | C25H37IN2O6 |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 5-[3-ethoxypropyl(pentanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCCCC(=O)N(CCCOCC)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C25H37IN2O6/c1-3-5-11-23(30)28(13-8-15-33-4-2)20-16-18(25(32)27-12-14-29)17-22(24(20)31)34-21-10-7-6-9-19(21)26/h6-7,9-10,17,20,22,24,29,31H,3-5,8,11-16H2,1-2H3,(H,27,32) |
| InChIKey | YVLZTONYXORXEO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|