C25H35IN2O6 — CID 6717522
(3S,4S,5R)-5-[cyclobutanecarbonyl(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 6717522) has the molecular formula C25H35IN2O6 and a molecular weight of 586.47 g/mol. Its IUPAC name is (3S,4S,5R)-5-[cyclobutanecarbonyl(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[cyclobutanecarbonyl(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717522 |
| Molecular Formula | C25H35IN2O6 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | (3S,4S,5R)-5-[cyclobutanecarbonyl(3-ethoxypropyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCOCCCN(C(=O)C1CCC1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C25H35IN2O6/c1-2-33-14-6-12-28(25(32)17-7-5-8-17)20-15-18(24(31)27-11-13-29)16-22(23(20)30)34-21-10-4-3-9-19(21)26/h3-4,9-10,16-17,20,22-23,29-30H,2,5-8,11-15H2,1H3,(H,27,31)/t20-,22+,23+/m1/s1 |
| InChIKey | DBBXZRJYLQYPMM-PUHATCMVSA-N |
| XLogP | 2.26 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|