C26H37IN2O7 — CID 6717560
N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide (PubChem CID 6717560) has the molecular formula C26H37IN2O7 and a molecular weight of 616.49 g/mol. Its IUPAC name is N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide.
| Compound Name | N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 6717560 |
| Molecular Formula | C26H37IN2O7 |
| Molecular Weight | 616.49 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-(2-iodophenoxy)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide |
| SMILES | CC(C)OCCCN(C(=O)C1CCOC1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C26H37IN2O7/c1-17(2)35-12-5-10-29(26(33)18-8-13-34-16-18)21-14-19(25(32)28-9-11-30)15-23(24(21)31)36-22-7-4-3-6-20(22)27/h3-4,6-7,15,17-18,21,23-24,30-31H,5,8-14,16H2,1-2H3,(H,28,32)/t18?,21-,23+,24+/m1/s1 |
| InChIKey | PTRJSGLQEYUTIP-PSKPQFHBSA-N |
| XLogP | 1.89 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|