C28H39IN2O9 — CID 6719348
N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide (PubChem CID 6719348) has the molecular formula C28H39IN2O9 and a molecular weight of 674.53 g/mol. Its IUPAC name is N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide.
| Compound Name | N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 6719348 |
| Molecular Formula | C28H39IN2O9 |
| Molecular Weight | 674.53 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | N-[(1R,5S,6S)-5-(4-formyl-2-iodo-6-methoxyphenoxy)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)cyclohex-3-en-1-yl]-N-(3-propan-2-yloxypropyl)oxolane-3-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CCCOC(C)C)C(=O)C2CCOC2)[C@@H]1O |
| InChI | InChI=1S/C28H39IN2O9/c1-17(2)39-9-4-7-31(28(36)19-5-10-38-16-19)22-13-20(27(35)30-6-8-32)14-23(25(22)34)40-26-21(29)11-18(15-33)12-24(26)37-3/h11-12,14-15,17,19,22-23,25,32,34H,4-10,13,16H2,1-3H3,(H,30,35)/t19?,22-,23+,25+/m1/s1 |
| InChIKey | IHIDHGHCVKYPST-JYJNSPSNSA-N |
| XLogP | 1.71 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|