C22H29IN2O8 — CID 4074338
5-[acetyl(2-methoxyethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4074338) has the molecular formula C22H29IN2O8 and a molecular weight of 576.38 g/mol. Its IUPAC name is 5-[acetyl(2-methoxyethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[acetyl(2-methoxyethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4074338 |
| Molecular Formula | C22H29IN2O8 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 5-[acetyl(2-methoxyethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COCCN(C(C)=O)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C22H29IN2O8/c1-13(28)25(5-7-31-2)17-10-15(22(30)24-4-6-26)11-18(20(17)29)33-21-16(23)8-14(12-27)9-19(21)32-3/h8-9,11-12,17-18,20,26,29H,4-7,10H2,1-3H3,(H,24,30) |
| InChIKey | HGMLDQSOSDDSQE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|