C31H37IN2O8 — CID 6719963
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethyl-(3-methylbut-2-enoyl)amino]cyclohexene-1-carboxamide (PubChem CID 6719963) has the molecular formula C31H37IN2O8 and a molecular weight of 692.55 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethyl-(3-methylbut-2-enoyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethyl-(3-methylbut-2-enoyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719963 |
| Molecular Formula | C31H37IN2O8 |
| Molecular Weight | 692.55 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethyl-(3-methylbut-2-enoyl)amino]cyclohexene-1-carboxamide |
| SMILES | COc1ccccc1CCN(C(=O)C=C(C)C)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C31H37IN2O8/c1-19(2)13-28(37)34(11-9-21-7-5-6-8-25(21)40-3)24-16-22(31(39)33-10-12-35)17-26(29(24)38)42-30-23(32)14-20(18-36)15-27(30)41-4/h5-8,13-15,17-18,24,26,29,35,38H,9-12,16H2,1-4H3,(H,33,39)/t24-,26+,29+/m1/s1 |
| InChIKey | OKRCQLQQXFOKMR-AZIXZEHSSA-N |
| XLogP | 3.07 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|