C28H32FIN2O7 — CID 4984830
5-[butanoyl-[(2-fluorophenyl)methyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4984830) has the molecular formula C28H32FIN2O7 and a molecular weight of 654.47 g/mol. Its IUPAC name is 5-[butanoyl-[(2-fluorophenyl)methyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[butanoyl-[(2-fluorophenyl)methyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4984830 |
| Molecular Formula | C28H32FIN2O7 |
| Molecular Weight | 654.47 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | 5-[butanoyl-[(2-fluorophenyl)methyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCCC(=O)N(Cc1ccccc1F)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C28H32FIN2O7/c1-3-6-25(35)32(15-18-7-4-5-8-20(18)29)22-13-19(28(37)31-9-10-33)14-23(26(22)36)39-27-21(30)11-17(16-34)12-24(27)38-2/h4-5,7-8,11-12,14,16,22-23,26,33,36H,3,6,9-10,13,15H2,1-2H3,(H,31,37) |
| InChIKey | YSXARFZABFCLNL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|