C29H34FIN2O7 — CID 3631290
5-[(2-fluorophenyl)methyl-pentanoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 3631290) has the molecular formula C29H34FIN2O7 and a molecular weight of 668.50 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl-pentanoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl-pentanoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 3631290 |
| Molecular Formula | C29H34FIN2O7 |
| Molecular Weight | 668.50 g/mol |
| Exact Mass | 668.14 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl-pentanoylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCCCC(=O)N(Cc1ccccc1F)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C29H34FIN2O7/c1-3-4-9-26(36)33(16-19-7-5-6-8-21(19)30)23-14-20(29(38)32-10-11-34)15-24(27(23)37)40-28-22(31)12-18(17-35)13-25(28)39-2/h5-8,12-13,15,17,23-24,27,34,37H,3-4,9-11,14,16H2,1-2H3,(H,32,38) |
| InChIKey | JTISGAOUVQJSJS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|