C31H47IN2O7 — CID 6719277
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hexyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719277) has the molecular formula C31H47IN2O7 and a molecular weight of 686.63 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hexyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hexyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719277 |
| Molecular Formula | C31H47IN2O7 |
| Molecular Weight | 686.63 g/mol |
| Exact Mass | 686.24 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-5-[hexyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(CCCCCC)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C31H47IN2O7/c1-4-6-8-10-11-13-28(37)34(15-12-9-7-5-2)25-19-23(31(39)33-14-16-35)20-26(29(25)38)41-30-24(32)17-22(21-36)18-27(30)40-3/h17-18,20-21,25-26,29,35,38H,4-16,19H2,1-3H3,(H,33,39)/t25-,26+,29+/m1/s1 |
| InChIKey | QQCUYLDYPOGPQK-ALTZYDRJSA-N |
| XLogP | 4.80 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|