C29H41IN2O8 — CID 6719316
(3S,4S,5R)-5-[(2-cyclopentylacetyl)-(3-ethoxypropyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719316) has the molecular formula C29H41IN2O8 and a molecular weight of 672.56 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(3-ethoxypropyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(3-ethoxypropyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719316 |
| Molecular Formula | C29H41IN2O8 |
| Molecular Weight | 672.56 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(3-ethoxypropyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCOCCCN(C(=O)CC1CCCC1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C29H41IN2O8/c1-3-39-12-6-10-32(26(35)15-19-7-4-5-8-19)23-16-21(29(37)31-9-11-33)17-24(27(23)36)40-28-22(30)13-20(18-34)14-25(28)38-2/h13-14,17-19,23-24,27,33,36H,3-12,15-16H2,1-2H3,(H,31,37)/t23-,24+,27+/m1/s1 |
| InChIKey | JQNRITRAERVXGF-DXBVXKBHSA-N |
| XLogP | 2.86 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|