C35H47IN2O7 — CID 6719616
(3S,4S,5R)-5-[1-adamantylmethyl-(2-cyclopentylacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719616) has the molecular formula C35H47IN2O7 and a molecular weight of 734.67 g/mol. Its IUPAC name is (3S,4S,5R)-5-[1-adamantylmethyl-(2-cyclopentylacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[1-adamantylmethyl-(2-cyclopentylacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719616 |
| Molecular Formula | C35H47IN2O7 |
| Molecular Weight | 734.67 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | (3S,4S,5R)-5-[1-adamantylmethyl-(2-cyclopentylacetyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CC23CC4CC(CC(C4)C2)C3)C(=O)CC2CCCC2)[C@@H]1O |
| InChI | InChI=1S/C35H47IN2O7/c1-44-30-12-25(19-40)11-27(36)33(30)45-29-15-26(34(43)37-6-7-39)14-28(32(29)42)38(31(41)13-21-4-2-3-5-21)20-35-16-22-8-23(17-35)10-24(9-22)18-35/h11-12,15,19,21-24,28-29,32,39,42H,2-10,13-14,16-18,20H2,1H3,(H,37,43)/t22?,23?,24?,28-,29+,32+,35?/m1/s1 |
| InChIKey | YSDKRYIMFIVBJP-NQPWNVHISA-N |
| XLogP | 4.65 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|