C26H32F3IN2O7 — CID 6719196
(3S,4S,5R)-5-[(2-cyclopentylacetyl)-(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719196) has the molecular formula C26H32F3IN2O7 and a molecular weight of 668.45 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719196 |
| Molecular Formula | C26H32F3IN2O7 |
| Molecular Weight | 668.45 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | (3S,4S,5R)-5-[(2-cyclopentylacetyl)-(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CC(F)(F)F)C(=O)CC2CCCC2)[C@@H]1O |
| InChI | InChI=1S/C26H32F3IN2O7/c1-38-21-9-16(13-34)8-18(30)24(21)39-20-12-17(25(37)31-6-7-33)11-19(23(20)36)32(14-26(27,28)29)22(35)10-15-4-2-3-5-15/h8-9,12-13,15,19-20,23,33,36H,2-7,10-11,14H2,1H3,(H,31,37)/t19-,20+,23+/m1/s1 |
| InChIKey | MPNPJLFSTYQCMD-QTEQDKRBSA-N |
| XLogP | 3.00 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|