C24H30F3IN2O7 — CID 6720977
(3S,4S,5R)-5-[cyclobutanecarbonyl(2,2,2-trifluoroethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide (PubChem CID 6720977) has the molecular formula C24H30F3IN2O7 and a molecular weight of 642.41 g/mol. Its IUPAC name is (3S,4S,5R)-5-[cyclobutanecarbonyl(2,2,2-trifluoroethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[cyclobutanecarbonyl(2,2,2-trifluoroethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6720977 |
| Molecular Formula | C24H30F3IN2O7 |
| Molecular Weight | 642.41 g/mol |
| Exact Mass | 642.10 |
| IUPAC Name | (3S,4S,5R)-5-[cyclobutanecarbonyl(2,2,2-trifluoroethyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohexene-1-carboxamide |
| SMILES | COc1cc(CO)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CC(F)(F)F)C(=O)C2CCC2)[C@@H]1O |
| InChI | InChI=1S/C24H30F3IN2O7/c1-36-19-8-13(11-32)7-16(28)21(19)37-18-10-15(22(34)29-5-6-31)9-17(20(18)33)30(12-24(25,26)27)23(35)14-3-2-4-14/h7-8,10,14,17-18,20,31-33H,2-6,9,11-12H2,1H3,(H,29,34)/t17-,18+,20+/m1/s1 |
| InChIKey | KJNOIALTKABSGT-HBFSDRIKSA-N |
| XLogP | 1.90 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|