C24H30F3IN2O7 — CID 6720972
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[pent-4-enoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide (PubChem CID 6720972) has the molecular formula C24H30F3IN2O7 and a molecular weight of 642.41 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[pent-4-enoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[pent-4-enoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6720972 |
| Molecular Formula | C24H30F3IN2O7 |
| Molecular Weight | 642.41 g/mol |
| Exact Mass | 642.10 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[pent-4-enoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
| SMILES | C=CCCC(=O)N(CC(F)(F)F)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(CO)cc2OC)[C@H]1O |
| InChI | InChI=1S/C24H30F3IN2O7/c1-3-4-5-20(33)30(13-24(25,26)27)17-10-15(23(35)29-6-7-31)11-18(21(17)34)37-22-16(28)8-14(12-32)9-19(22)36-2/h3,8-9,11,17-18,21,31-32,34H,1,4-7,10,12-13H2,2H3,(H,29,35)/t17-,18+,21+/m1/s1 |
| InChIKey | POIYPZMTIXWHTH-LQWHRVPQSA-N |
| XLogP | 2.06 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|