C27H27F6IN2O7 — CID 6720984
N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohex-3-en-1-yl]-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzamide (PubChem CID 6720984) has the molecular formula C27H27F6IN2O7 and a molecular weight of 732.41 g/mol. Its IUPAC name is N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohex-3-en-1-yl]-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohex-3-en-1-yl]-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 6720984 |
| Molecular Formula | C27H27F6IN2O7 |
| Molecular Weight | 732.41 g/mol |
| Exact Mass | 732.08 |
| IUPAC Name | N-[(1R,5S,6S)-6-hydroxy-3-(2-hydroxyethylcarbamoyl)-5-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]cyclohex-3-en-1-yl]-N-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(CO)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](N(CC(F)(F)F)C(=O)c2ccc(C(F)(F)F)cc2)[C@@H]1O |
| InChI | InChI=1S/C27H27F6IN2O7/c1-42-21-9-14(12-38)8-18(34)23(21)43-20-11-16(24(40)35-6-7-37)10-19(22(20)39)36(13-26(28,29)30)25(41)15-2-4-17(5-3-15)27(31,32)33/h2-5,8-9,11,19-20,22,37-39H,6-7,10,12-13H2,1H3,(H,35,40)/t19-,20+,22+/m1/s1 |
| InChIKey | RWGIEFFEIYCYEW-URVUXULASA-N |
| XLogP | 3.43 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|