C27H38F3IN2O7 — CID 6720974
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[octanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide (PubChem CID 6720974) has the molecular formula C27H38F3IN2O7 and a molecular weight of 686.51 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[octanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[octanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6720974 |
| Molecular Formula | C27H38F3IN2O7 |
| Molecular Weight | 686.51 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-[4-(hydroxymethyl)-2-iodo-6-methoxyphenoxy]-5-[octanoyl(2,2,2-trifluoroethyl)amino]cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(CC(F)(F)F)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(CO)cc2OC)[C@H]1O |
| InChI | InChI=1S/C27H38F3IN2O7/c1-3-4-5-6-7-8-23(36)33(16-27(28,29)30)20-13-18(26(38)32-9-10-34)14-21(24(20)37)40-25-19(31)11-17(15-35)12-22(25)39-2/h11-12,14,20-21,24,34-35,37H,3-10,13,15-16H2,1-2H3,(H,32,38)/t20-,21+,24+/m1/s1 |
| InChIKey | VYGZTEIMSDTNFB-DPLHUUCSSA-N |
| XLogP | 3.46 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|