C23H28F3IN2O7 — CID 6719178
(3S,4S,5R)-5-[butanoyl(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 6719178) has the molecular formula C23H28F3IN2O7 and a molecular weight of 628.38 g/mol. Its IUPAC name is (3S,4S,5R)-5-[butanoyl(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[butanoyl(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6719178 |
| Molecular Formula | C23H28F3IN2O7 |
| Molecular Weight | 628.38 g/mol |
| Exact Mass | 628.09 |
| IUPAC Name | (3S,4S,5R)-5-[butanoyl(2,2,2-trifluoroethyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCCC(=O)N(CC(F)(F)F)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2c(I)cc(C=O)cc2OC)[C@H]1O |
| InChI | InChI=1S/C23H28F3IN2O7/c1-3-4-19(32)29(12-23(24,25)26)16-9-14(22(34)28-5-6-30)10-17(20(16)33)36-21-15(27)7-13(11-31)8-18(21)35-2/h7-8,10-11,16-17,20,30,33H,3-6,9,12H2,1-2H3,(H,28,34)/t16-,17+,20+/m1/s1 |
| InChIKey | CMZNMNQDEZHKPY-UWVAXJGDSA-N |
| XLogP | 2.22 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|