C19H22F3IN2O6 — CID 6717326
(3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)cyclohexene-1-carboxamide (PubChem CID 6717326) has the molecular formula C19H22F3IN2O6 and a molecular weight of 558.29 g/mol. Its IUPAC name is (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717326 |
| Molecular Formula | C19H22F3IN2O6 |
| Molecular Weight | 558.29 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | (3S,4S,5R)-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-(2,2,2-trifluoroethylamino)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1O[C@H]1C=C(C(=O)NCCO)C[C@@H](NCC(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C19H22F3IN2O6/c1-30-15-5-10(8-27)4-12(23)17(15)31-14-7-11(18(29)24-2-3-26)6-13(16(14)28)25-9-19(20,21)22/h4-5,7-8,13-14,16,25-26,28H,2-3,6,9H2,1H3,(H,24,29)/t13-,14+,16+/m1/s1 |
| InChIKey | XZRTVDBJYHALAS-YCPHGPKFSA-N |
| XLogP | 1.18 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|