C25H28FIN2O6 — CID 5102391
5-[2-(3-fluorophenyl)ethylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 5102391) has the molecular formula C25H28FIN2O6 and a molecular weight of 598.41 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)ethylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[2-(3-fluorophenyl)ethylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 5102391 |
| Molecular Formula | C25H28FIN2O6 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | 5-[2-(3-fluorophenyl)ethylamino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | COc1cc(C=O)cc(I)c1OC1C=C(C(=O)NCCO)CC(NCCc2cccc(F)c2)C1O |
| InChI | InChI=1S/C25H28FIN2O6/c1-34-22-11-16(14-31)10-19(27)24(22)35-21-13-17(25(33)29-7-8-30)12-20(23(21)32)28-6-5-15-3-2-4-18(26)9-15/h2-4,9-11,13-14,20-21,23,28,30,32H,5-8,12H2,1H3,(H,29,33) |
| InChIKey | KSHONSNQIPQIQE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|