C30H37IN2O8 — CID 4169451
5-[butanoyl-[2-(3-methoxyphenyl)ethyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4169451) has the molecular formula C30H37IN2O8 and a molecular weight of 680.54 g/mol. Its IUPAC name is 5-[butanoyl-[2-(3-methoxyphenyl)ethyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[butanoyl-[2-(3-methoxyphenyl)ethyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4169451 |
| Molecular Formula | C30H37IN2O8 |
| Molecular Weight | 680.54 g/mol |
| Exact Mass | 680.16 |
| IUPAC Name | 5-[butanoyl-[2-(3-methoxyphenyl)ethyl]amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | CCCC(=O)N(CCc1cccc(OC)c1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C30H37IN2O8/c1-4-6-27(36)33(11-9-19-7-5-8-22(13-19)39-2)24-16-21(30(38)32-10-12-34)17-25(28(24)37)41-29-23(31)14-20(18-35)15-26(29)40-3/h5,7-8,13-15,17-18,24-25,28,34,37H,4,6,9-12,16H2,1-3H3,(H,32,38) |
| InChIKey | QQAYIINVQPRRKS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|