C26H31IN2O7 — CID 4118597
3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethylamino]cyclohexene-1-carboxamide (PubChem CID 4118597) has the molecular formula C26H31IN2O7 and a molecular weight of 610.45 g/mol. Its IUPAC name is 3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethylamino]cyclohexene-1-carboxamide.
| Compound Name | 3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethylamino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4118597 |
| Molecular Formula | C26H31IN2O7 |
| Molecular Weight | 610.45 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)-5-[2-(2-methoxyphenyl)ethylamino]cyclohexene-1-carboxamide |
| SMILES | COc1ccccc1CCNC1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C26H31IN2O7/c1-34-21-6-4-3-5-17(21)7-8-28-20-13-18(26(33)29-9-10-30)14-22(24(20)32)36-25-19(27)11-16(15-31)12-23(25)35-2/h3-6,11-12,14-15,20,22,24,28,30,32H,7-10,13H2,1-2H3,(H,29,33) |
| InChIKey | LQTOIDZMFAKWEA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|