C18H25IN2O5 — CID 6717297
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-(2-methoxyethylamino)cyclohexene-1-carboxamide (PubChem CID 6717297) has the molecular formula C18H25IN2O5 and a molecular weight of 476.31 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-(2-methoxyethylamino)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-(2-methoxyethylamino)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6717297 |
| Molecular Formula | C18H25IN2O5 |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-(2-methoxyethylamino)cyclohexene-1-carboxamide |
| SMILES | COCCN[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C18H25IN2O5/c1-25-9-7-20-14-10-12(18(24)21-6-8-22)11-16(17(14)23)26-15-5-3-2-4-13(15)19/h2-5,11,14,16-17,20,22-23H,6-10H2,1H3,(H,21,24)/t14-,16+,17+/m1/s1 |
| InChIKey | CXGXMKBYJTWYCJ-PVAVHDDUSA-N |
| XLogP | 0.44 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|