C22H24FIN2O3 — CID 24995446
(3S,4S,5R)-N-ethyl-5-[(4-fluorophenyl)methylamino]-4-hydroxy-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 24995446) has the molecular formula C22H24FIN2O3 and a molecular weight of 510.35 g/mol. Its IUPAC name is (3S,4S,5R)-N-ethyl-5-[(4-fluorophenyl)methylamino]-4-hydroxy-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-N-ethyl-5-[(4-fluorophenyl)methylamino]-4-hydroxy-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 24995446 |
| Molecular Formula | C22H24FIN2O3 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | (3S,4S,5R)-N-ethyl-5-[(4-fluorophenyl)methylamino]-4-hydroxy-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCNC(=O)C1=C[C@H](Oc2ccccc2I)[C@@H](O)[C@H](NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H24FIN2O3/c1-2-25-22(28)15-11-18(26-13-14-7-9-16(23)10-8-14)21(27)20(12-15)29-19-6-4-3-5-17(19)24/h3-10,12,18,20-21,26-27H,2,11,13H2,1H3,(H,25,28)/t18-,20+,21+/m1/s1 |
| InChIKey | SORCATCJKLOFRZ-GIVPXCGWSA-N |
| XLogP | 3.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|