C28H32FIN2O5 — CID 4094967
5-[2-(3-fluorophenyl)ethyl-(3-methylbut-2-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 4094967) has the molecular formula C28H32FIN2O5 and a molecular weight of 622.48 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)ethyl-(3-methylbut-2-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[2-(3-fluorophenyl)ethyl-(3-methylbut-2-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4094967 |
| Molecular Formula | C28H32FIN2O5 |
| Molecular Weight | 622.48 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | 5-[2-(3-fluorophenyl)ethyl-(3-methylbut-2-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CC(C)=CC(=O)N(CCc1cccc(F)c1)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C28H32FIN2O5/c1-18(2)14-26(34)32(12-10-19-6-5-7-21(29)15-19)23-16-20(28(36)31-11-13-33)17-25(27(23)35)37-24-9-4-3-8-22(24)30/h3-9,14-15,17,23,25,27,33,35H,10-13,16H2,1-2H3,(H,31,36) |
| InChIKey | ALGYMKFBNSNIBD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|