C29H35IN2O6 — CID 6718176
(3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[2-(2-methoxyphenyl)ethyl-pent-2-enoylamino]cyclohexene-1-carboxamide (PubChem CID 6718176) has the molecular formula C29H35IN2O6 and a molecular weight of 634.51 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[2-(2-methoxyphenyl)ethyl-pent-2-enoylamino]cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[2-(2-methoxyphenyl)ethyl-pent-2-enoylamino]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6718176 |
| Molecular Formula | C29H35IN2O6 |
| Molecular Weight | 634.51 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)-5-[2-(2-methoxyphenyl)ethyl-pent-2-enoylamino]cyclohexene-1-carboxamide |
| SMILES | CCC=CC(=O)N(CCc1ccccc1OC)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C29H35IN2O6/c1-3-4-13-27(34)32(16-14-20-9-5-7-11-24(20)37-2)23-18-21(29(36)31-15-17-33)19-26(28(23)35)38-25-12-8-6-10-22(25)30/h4-13,19,23,26,28,33,35H,3,14-18H2,1-2H3,(H,31,36)/t23-,26+,28+/m1/s1 |
| InChIKey | KFZIFOZLMSVQRT-KHGZIGHDSA-N |
| XLogP | 3.25 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|