C27H29Cl2IN2O5 — CID 5115084
5-[(3,4-dichlorophenyl)methyl-pent-2-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 5115084) has the molecular formula C27H29Cl2IN2O5 and a molecular weight of 659.35 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methyl-pent-2-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[(3,4-dichlorophenyl)methyl-pent-2-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 5115084 |
| Molecular Formula | C27H29Cl2IN2O5 |
| Molecular Weight | 659.35 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methyl-pent-2-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCC=CC(=O)N(Cc1ccc(Cl)c(Cl)c1)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C27H29Cl2IN2O5/c1-2-3-8-25(34)32(16-17-9-10-19(28)20(29)13-17)22-14-18(27(36)31-11-12-33)15-24(26(22)35)37-23-7-5-4-6-21(23)30/h3-10,13,15,22,24,26,33,35H,2,11-12,14,16H2,1H3,(H,31,36) |
| InChIKey | AMEHPVRSDVXTBO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|