C27H30ClIN2O5 — CID 6718027
(3S,4S,5R)-5-[(4-chlorophenyl)methyl-pent-4-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 6718027) has the molecular formula C27H30ClIN2O5 and a molecular weight of 624.90 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(4-chlorophenyl)methyl-pent-4-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[(4-chlorophenyl)methyl-pent-4-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6718027 |
| Molecular Formula | C27H30ClIN2O5 |
| Molecular Weight | 624.90 g/mol |
| Exact Mass | 624.09 |
| IUPAC Name | (3S,4S,5R)-5-[(4-chlorophenyl)methyl-pent-4-enoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | C=CCCC(=O)N(Cc1ccc(Cl)cc1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C27H30ClIN2O5/c1-2-3-8-25(33)31(17-18-9-11-20(28)12-10-18)22-15-19(27(35)30-13-14-32)16-24(26(22)34)36-23-7-5-4-6-21(23)29/h2,4-7,9-12,16,22,24,26,32,34H,1,3,8,13-15,17H2,(H,30,35)/t22-,24+,26+/m1/s1 |
| InChIKey | URDYNZXFAPMBNH-CWDLOFLHSA-N |
| XLogP | 3.86 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|