C30H37Cl2IN2O5 — CID 6718059
(3S,4S,5R)-5-[(3,4-dichlorophenyl)methyl-octanoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 6718059) has the molecular formula C30H37Cl2IN2O5 and a molecular weight of 703.45 g/mol. Its IUPAC name is (3S,4S,5R)-5-[(3,4-dichlorophenyl)methyl-octanoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | (3S,4S,5R)-5-[(3,4-dichlorophenyl)methyl-octanoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 6718059 |
| Molecular Formula | C30H37Cl2IN2O5 |
| Molecular Weight | 703.45 g/mol |
| Exact Mass | 702.11 |
| IUPAC Name | (3S,4S,5R)-5-[(3,4-dichlorophenyl)methyl-octanoylamino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(Cc1ccc(Cl)c(Cl)c1)[C@@H]1CC(C(=O)NCCO)=C[C@H](Oc2ccccc2I)[C@H]1O |
| InChI | InChI=1S/C30H37Cl2IN2O5/c1-2-3-4-5-6-11-28(37)35(19-20-12-13-22(31)23(32)16-20)25-17-21(30(39)34-14-15-36)18-27(29(25)38)40-26-10-8-7-9-24(26)33/h7-10,12-13,16,18,25,27,29,36,38H,2-6,11,14-15,17,19H2,1H3,(H,34,39)/t25-,27+,29+/m1/s1 |
| InChIKey | WZVNBQABKMZITR-WBJKNQCFSA-N |
| XLogP | 5.90 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|