C30H45IN2O5 — CID 3620140
5-[cycloheptyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 3620140) has the molecular formula C30H45IN2O5 and a molecular weight of 640.60 g/mol. Its IUPAC name is 5-[cycloheptyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[cycloheptyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 3620140 |
| Molecular Formula | C30H45IN2O5 |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 5-[cycloheptyl(octanoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | CCCCCCCC(=O)N(C1CCCCCC1)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C30H45IN2O5/c1-2-3-4-5-10-17-28(35)33(23-13-8-6-7-9-14-23)25-20-22(30(37)32-18-19-34)21-27(29(25)36)38-26-16-12-11-15-24(26)31/h11-12,15-16,21,23,25,27,29,34,36H,2-10,13-14,17-20H2,1H3,(H,32,37) |
| InChIKey | NHKLTAUNLWNISR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|