C27H37IN2O5 — CID 3508818
5-[cycloheptyl(pent-4-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide (PubChem CID 3508818) has the molecular formula C27H37IN2O5 and a molecular weight of 596.51 g/mol. Its IUPAC name is 5-[cycloheptyl(pent-4-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide.
| Compound Name | 5-[cycloheptyl(pent-4-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 3508818 |
| Molecular Formula | C27H37IN2O5 |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 5-[cycloheptyl(pent-4-enoyl)amino]-4-hydroxy-N-(2-hydroxyethyl)-3-(2-iodophenoxy)cyclohexene-1-carboxamide |
| SMILES | C=CCCC(=O)N(C1CCCCCC1)C1CC(C(=O)NCCO)=CC(Oc2ccccc2I)C1O |
| InChI | InChI=1S/C27H37IN2O5/c1-2-3-14-25(32)30(20-10-6-4-5-7-11-20)22-17-19(27(34)29-15-16-31)18-24(26(22)33)35-23-13-9-8-12-21(23)28/h2,8-9,12-13,18,20,22,24,26,31,33H,1,3-7,10-11,14-17H2,(H,29,34) |
| InChIKey | FHHJBZITSIMOPY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|