C27H35IN2O7 — CID 4071036
5-[cyclopentyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide (PubChem CID 4071036) has the molecular formula C27H35IN2O7 and a molecular weight of 626.49 g/mol. Its IUPAC name is 5-[cyclopentyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide.
| Compound Name | 5-[cyclopentyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 4071036 |
| Molecular Formula | C27H35IN2O7 |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 5-[cyclopentyl(pent-4-enoyl)amino]-3-(4-formyl-2-iodo-6-methoxyphenoxy)-4-hydroxy-N-(2-hydroxyethyl)cyclohexene-1-carboxamide |
| SMILES | C=CCCC(=O)N(C1CCCC1)C1CC(C(=O)NCCO)=CC(Oc2c(I)cc(C=O)cc2OC)C1O |
| InChI | InChI=1S/C27H35IN2O7/c1-3-4-9-24(33)30(19-7-5-6-8-19)21-14-18(27(35)29-10-11-31)15-22(25(21)34)37-26-20(28)12-17(16-32)13-23(26)36-2/h3,12-13,15-16,19,21-22,25,31,34H,1,4-11,14H2,2H3,(H,29,35) |
| InChIKey | UYZYLOYRTZENJS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|